C25H39N3O5 — CID 18033387
tert-butyl N-[3-hydroxy-1-[[1-(4-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18033387) has the molecular formula C25H39N3O5 and a molecular weight of 461.60 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-1-[[1-(4-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-1-[[1-(4-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18033387 |
| Molecular Formula | C25H39N3O5 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | tert-butyl N-[3-hydroxy-1-[[1-(4-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | C=CCN(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H39N3O5/c1-7-9-10-15-26-22(30)21(19-13-11-18(3)12-14-19)28(16-8-2)23(31)20(17-29)27-24(32)33-25(4,5)6/h8,11-14,20-21,29H,2,7,9-10,15-17H2,1,3-6H3,(H,26,30)(H,27,32) |
| InChIKey | LIHUGVZNMVGSIE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|