C28H45N3O4 — CID 18044890
tert-butyl N-[1-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-prop-2-enylamino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18044890) has the molecular formula C28H45N3O4 and a molecular weight of 487.69 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-prop-2-enylamino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-prop-2-enylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18044890 |
| Molecular Formula | C28H45N3O4 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.34 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-prop-2-enylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | C=CCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)NCCCC)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C28H45N3O4/c1-10-12-13-29-25(32)24(22-17-20(5)16-21(6)18-22)31(14-11-2)26(33)23(15-19(3)4)30-27(34)35-28(7,8)9/h11,16-19,23-24H,2,10,12-15H2,1,3-9H3,(H,29,32)(H,30,34) |
| InChIKey | DJOXYALHNDMMJZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|