C27H43N3O4 — CID 18039190
tert-butyl N-[1-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-prop-2-enylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 18039190) has the molecular formula C27H43N3O4 and a molecular weight of 473.66 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-prop-2-enylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-prop-2-enylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18039190 |
| Molecular Formula | C27H43N3O4 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.33 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-prop-2-enylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C=CCN(C(=O)C(NC(=O)OC(C)(C)C)C(C)C)C(C(=O)NCCCC)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C27H43N3O4/c1-10-12-13-28-24(31)23(21-16-19(5)15-20(6)17-21)30(14-11-2)25(32)22(18(3)4)29-26(33)34-27(7,8)9/h11,15-18,22-23H,2,10,12-14H2,1,3-9H3,(H,28,31)(H,29,33) |
| InChIKey | AYYFKHDWKAXOSQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|