C24H39N3O6 — CID 18034645
tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-propan-2-ylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 18034645) has the molecular formula C24H39N3O6 and a molecular weight of 465.59 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-propan-2-ylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-propan-2-ylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18034645 |
| Molecular Formula | C24H39N3O6 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-propan-2-ylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1cccc(C)c1O)N(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C24H39N3O6/c1-8-9-13-25-21(30)19(17-12-10-11-16(4)20(17)29)27(15(2)3)22(31)18(14-28)26-23(32)33-24(5,6)7/h10-12,15,18-19,28-29H,8-9,13-14H2,1-7H3,(H,25,30)(H,26,32) |
| InChIKey | GPGICQOUIQLNJI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|