C29H38N4O5 — CID 18044463
tert-butyl N-[1-[cyanomethyl-[2-(2,6-dimethylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18044463) has the molecular formula C29H38N4O5 and a molecular weight of 522.65 g/mol. Its IUPAC name is tert-butyl N-[1-[cyanomethyl-[2-(2,6-dimethylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyanomethyl-[2-(2,6-dimethylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18044463 |
| Molecular Formula | C29H38N4O5 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | tert-butyl N-[1-[cyanomethyl-[2-(2,6-dimethylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | Cc1cccc(C)c1NC(=O)C(c1ccccc1O)N(CC#N)C(=O)C(CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H38N4O5/c1-18(2)17-22(31-28(37)38-29(5,6)7)27(36)33(16-15-30)25(21-13-8-9-14-23(21)34)26(35)32-24-19(3)11-10-12-20(24)4/h8-14,18,22,25,34H,16-17H2,1-7H3,(H,31,37)(H,32,35) |
| InChIKey | YTZOXIPXMZXDKF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 131.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|