C28H36N4O5 — CID 18021660
tert-butyl N-[1-[cyanomethyl-[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18021660) has the molecular formula C28H36N4O5 and a molecular weight of 508.62 g/mol. Its IUPAC name is tert-butyl N-[1-[cyanomethyl-[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyanomethyl-[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18021660 |
| Molecular Formula | C28H36N4O5 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | tert-butyl N-[1-[cyanomethyl-[1-(2-hydroxyphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCC(C)C(NC(=O)OC(C)(C)C)C(=O)N(CC#N)C(C(=O)Nc1ccccc1C)c1ccccc1O |
| InChI | InChI=1S/C28H36N4O5/c1-7-18(2)23(31-27(36)37-28(4,5)6)26(35)32(17-16-29)24(20-13-9-11-15-22(20)33)25(34)30-21-14-10-8-12-19(21)3/h8-15,18,23-24,33H,7,17H2,1-6H3,(H,30,34)(H,31,36) |
| InChIKey | XLQYSIMOGCFXSX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 131.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|