C29H34N4O4 — CID 18038865
tert-butyl N-[1-[cyanomethyl-[1-(2-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 18038865) has the molecular formula C29H34N4O4 and a molecular weight of 502.62 g/mol. Its IUPAC name is tert-butyl N-[1-[cyanomethyl-[1-(2-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyanomethyl-[1-(2-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18038865 |
| Molecular Formula | C29H34N4O4 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | tert-butyl N-[1-[cyanomethyl-[1-(2-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1ccccc1C)N(CC#N)C(=O)C(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C29H34N4O4/c1-8-21-14-10-11-15-22(21)25(26(34)31-23-16-12-9-13-20(23)4)33(18-17-30)27(35)24(19(2)3)32-28(36)37-29(5,6)7/h1,9-16,19,24-25H,18H2,2-7H3,(H,31,34)(H,32,36) |
| InChIKey | JWPOXEGZVFOCJA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|