C31H34N4O5 — CID 18050056
tert-butyl N-[4-amino-1-[[1-(2,4-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-ethynylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18050056) has the molecular formula C31H34N4O5 and a molecular weight of 542.64 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[1-(2,4-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-ethynylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[1-(2,4-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-ethynylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18050056 |
| Molecular Formula | C31H34N4O5 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[1-(2,4-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-ethynylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1ccc(C)cc1C |
| InChI | InChI=1S/C31H34N4O5/c1-7-35(29(38)25(18-26(32)36)34-30(39)40-31(4,5)6)27(24-15-12-19(2)16-20(24)3)28(37)33-23-14-13-21-10-8-9-11-22(21)17-23/h1,8-17,25,27H,18H2,2-6H3,(H2,32,36)(H,33,37)(H,34,39) |
| InChIKey | XFLTZZYVORHDOF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|