C27H34N4O5S — CID 18056074
tert-butyl N-[1-[cyanomethyl-[1-(3,4-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18056074) has the molecular formula C27H34N4O5S and a molecular weight of 526.66 g/mol. Its IUPAC name is tert-butyl N-[1-[cyanomethyl-[1-(3,4-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyanomethyl-[1-(3,4-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18056074 |
| Molecular Formula | C27H34N4O5S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | tert-butyl N-[1-[cyanomethyl-[1-(3,4-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | COc1ccc(NC(=O)C(c2ccc(C)c(C)c2)N(CC#N)C(=O)C(CS)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H34N4O5S/c1-17-7-8-19(15-18(17)2)23(24(32)29-20-9-11-21(35-6)12-10-20)31(14-13-28)25(33)22(16-37)30-26(34)36-27(3,4)5/h7-12,15,22-23,37H,14,16H2,1-6H3,(H,29,32)(H,30,34) |
| InChIKey | XHCLYVCFGKQSIW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|