C27H30N4O5S — CID 18055954
tert-butyl N-[1-[cyanomethyl-[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18055954) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is tert-butyl N-[1-[cyanomethyl-[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyanomethyl-[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18055954 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | tert-butyl N-[1-[cyanomethyl-[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)Nc2ccc(OC)cc2)N(CC#N)C(=O)C(CS)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H30N4O5S/c1-6-18-7-9-19(10-8-18)23(24(32)29-20-11-13-21(35-5)14-12-20)31(16-15-28)25(33)22(17-37)30-26(34)36-27(2,3)4/h1,7-14,22-23,37H,16-17H2,2-5H3,(H,29,32)(H,30,34) |
| InChIKey | ZAYAIPAJYVHUEB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|