C29H35N3O5S — CID 18057664
tert-butyl N-[1-[cyclobutyl-[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18057664) has the molecular formula C29H35N3O5S and a molecular weight of 537.68 g/mol. Its IUPAC name is tert-butyl N-[1-[cyclobutyl-[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyclobutyl-[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18057664 |
| Molecular Formula | C29H35N3O5S |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | tert-butyl N-[1-[cyclobutyl-[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)Nc2ccc(OC)cc2)N(C(=O)C(CS)NC(=O)OC(C)(C)C)C2CCC2)cc1 |
| InChI | InChI=1S/C29H35N3O5S/c1-6-19-10-12-20(13-11-19)25(26(33)30-21-14-16-23(36-5)17-15-21)32(22-8-7-9-22)27(34)24(18-38)31-28(35)37-29(2,3)4/h1,10-17,22,24-25,38H,7-9,18H2,2-5H3,(H,30,33)(H,31,35) |
| InChIKey | GEDSBBMKQDVELU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|