C27H35N3O6S — CID 18057574
tert-butyl N-[1-[cyclobutyl-[1-(2-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18057574) has the molecular formula C27H35N3O6S and a molecular weight of 529.66 g/mol. Its IUPAC name is tert-butyl N-[1-[cyclobutyl-[1-(2-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyclobutyl-[1-(2-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18057574 |
| Molecular Formula | C27H35N3O6S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | tert-butyl N-[1-[cyclobutyl-[1-(2-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | COc1ccc(NC(=O)C(c2ccccc2O)N(C(=O)C(CS)NC(=O)OC(C)(C)C)C2CCC2)cc1 |
| InChI | InChI=1S/C27H35N3O6S/c1-27(2,3)36-26(34)29-21(16-37)25(33)30(18-8-7-9-18)23(20-10-5-6-11-22(20)31)24(32)28-17-12-14-19(35-4)15-13-17/h5-6,10-15,18,21,23,31,37H,7-9,16H2,1-4H3,(H,28,32)(H,29,34) |
| InChIKey | WKFRUVOVYNFCHR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|