C26H37N3O4S — CID 18057669
tert-butyl N-[1-[[2-(tert-butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-cyclobutylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18057669) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(tert-butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-cyclobutylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(tert-butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-cyclobutylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18057669 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | tert-butyl N-[1-[[2-(tert-butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]-cyclobutylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NC(C)(C)C)N(C(=O)C(CS)NC(=O)OC(C)(C)C)C1CCC1 |
| InChI | InChI=1S/C26H37N3O4S/c1-8-17-12-9-10-15-19(17)21(22(30)28-25(2,3)4)29(18-13-11-14-18)23(31)20(16-34)27-24(32)33-26(5,6)7/h1,9-10,12,15,18,20-21,34H,11,13-14,16H2,2-7H3,(H,27,32)(H,28,30) |
| InChIKey | IOHXGGRDZGKJIU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|