C26H38N4O4S — CID 18056098
tert-butyl N-[1-[cyanomethyl-[2-(cyclohexylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18056098) has the molecular formula C26H38N4O4S and a molecular weight of 502.68 g/mol. Its IUPAC name is tert-butyl N-[1-[cyanomethyl-[2-(cyclohexylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[cyanomethyl-[2-(cyclohexylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18056098 |
| Molecular Formula | C26H38N4O4S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | tert-butyl N-[1-[cyanomethyl-[2-(cyclohexylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | Cc1ccc(C)c(C(C(=O)NC2CCCCC2)N(CC#N)C(=O)C(CS)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H38N4O4S/c1-17-11-12-18(2)20(15-17)22(23(31)28-19-9-7-6-8-10-19)30(14-13-27)24(32)21(16-35)29-25(33)34-26(3,4)5/h11-12,15,19,21-22,35H,6-10,14,16H2,1-5H3,(H,28,31)(H,29,33) |
| InChIKey | PHBTZZBNMLHDCC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|