C27H34N4O4S — CID 18056099
tert-butyl N-[1-[[2-(benzylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18056099) has the molecular formula C27H34N4O4S and a molecular weight of 510.66 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(benzylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(benzylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18056099 |
| Molecular Formula | C27H34N4O4S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | tert-butyl N-[1-[[2-(benzylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | Cc1ccc(C)c(C(C(=O)NCc2ccccc2)N(CC#N)C(=O)C(CS)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C27H34N4O4S/c1-18-11-12-19(2)21(15-18)23(24(32)29-16-20-9-7-6-8-10-20)31(14-13-28)25(33)22(17-36)30-26(34)35-27(3,4)5/h6-12,15,22-23,36H,14,16-17H2,1-5H3,(H,29,32)(H,30,34) |
| InChIKey | BGRQRUAALOCUCR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|