C23H35N3O5S — CID 18056200
tert-butyl N-[1-[[2-(butylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-prop-2-enylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18056200) has the molecular formula C23H35N3O5S and a molecular weight of 465.62 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-prop-2-enylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-prop-2-enylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18056200 |
| Molecular Formula | C23H35N3O5S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-prop-2-enylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | C=CCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NCCCC)c1cccc(O)c1 |
| InChI | InChI=1S/C23H35N3O5S/c1-6-8-12-24-20(28)19(16-10-9-11-17(27)14-16)26(13-7-2)21(29)18(15-32)25-22(30)31-23(3,4)5/h7,9-11,14,18-19,27,32H,2,6,8,12-13,15H2,1,3-5H3,(H,24,28)(H,25,30) |
| InChIKey | ODPXLCIDHYAQLX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|