C22H35N3O6S — CID 18056770
tert-butyl N-[1-[[2-(butylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-(2-hydroxyethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18056770) has the molecular formula C22H35N3O6S and a molecular weight of 469.60 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-(2-hydroxyethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-(2-hydroxyethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18056770 |
| Molecular Formula | C22H35N3O6S |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-(2-hydroxyethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1cccc(O)c1)N(CCO)C(=O)C(CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35N3O6S/c1-5-6-10-23-19(28)18(15-8-7-9-16(27)13-15)25(11-12-26)20(29)17(14-32)24-21(30)31-22(2,3)4/h7-9,13,17-18,26-27,32H,5-6,10-12,14H2,1-4H3,(H,23,28)(H,24,30) |
| InChIKey | PGNPXKFELZWLOR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|