C25H37N3O7S — CID 18056316
ethyl 3-[[2-(2-hydroxy-3-methylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-prop-2-enylamino]acetyl]amino]propanoate (PubChem CID 18056316) has the molecular formula C25H37N3O7S and a molecular weight of 523.65 g/mol. Its IUPAC name is ethyl 3-[[2-(2-hydroxy-3-methylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-prop-2-enylamino]acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-(2-hydroxy-3-methylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-prop-2-enylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18056316 |
| Molecular Formula | C25H37N3O7S |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | ethyl 3-[[2-(2-hydroxy-3-methylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-prop-2-enylamino]acetyl]amino]propanoate |
| SMILES | C=CCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NCCC(=O)OCC)c1cccc(C)c1O |
| InChI | InChI=1S/C25H37N3O7S/c1-7-14-28(23(32)18(15-36)27-24(33)35-25(4,5)6)20(17-11-9-10-16(3)21(17)30)22(31)26-13-12-19(29)34-8-2/h7,9-11,18,20,30,36H,1,8,12-15H2,2-6H3,(H,26,31)(H,27,33) |
| InChIKey | UTFDSMPJBUHLMT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|