C26H43N3O4S — CID 18058600
tert-butyl N-[1-[butyl-[2-(butylamino)-1-(2,4-dimethylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18058600) has the molecular formula C26H43N3O4S and a molecular weight of 493.71 g/mol. Its IUPAC name is tert-butyl N-[1-[butyl-[2-(butylamino)-1-(2,4-dimethylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[butyl-[2-(butylamino)-1-(2,4-dimethylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18058600 |
| Molecular Formula | C26H43N3O4S |
| Molecular Weight | 493.71 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | tert-butyl N-[1-[butyl-[2-(butylamino)-1-(2,4-dimethylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1ccc(C)cc1C)N(CCCC)C(=O)C(CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H43N3O4S/c1-8-10-14-27-23(30)22(20-13-12-18(3)16-19(20)4)29(15-11-9-2)24(31)21(17-34)28-25(32)33-26(5,6)7/h12-13,16,21-22,34H,8-11,14-15,17H2,1-7H3,(H,27,30)(H,28,32) |
| InChIKey | WJBHPWRQCQVSFN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.71 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|