C24H39N3O5S — CID 18056890
tert-butyl N-[1-[[2-(butylamino)-1-(2,4-dimethylphenyl)-2-oxoethyl]-(2-hydroxyethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18056890) has the molecular formula C24H39N3O5S and a molecular weight of 481.66 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(2,4-dimethylphenyl)-2-oxoethyl]-(2-hydroxyethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(2,4-dimethylphenyl)-2-oxoethyl]-(2-hydroxyethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18056890 |
| Molecular Formula | C24H39N3O5S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(2,4-dimethylphenyl)-2-oxoethyl]-(2-hydroxyethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1ccc(C)cc1C)N(CCO)C(=O)C(CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H39N3O5S/c1-7-8-11-25-21(29)20(18-10-9-16(2)14-17(18)3)27(12-13-28)22(30)19(15-33)26-23(31)32-24(4,5)6/h9-10,14,19-20,28,33H,7-8,11-13,15H2,1-6H3,(H,25,29)(H,26,31) |
| InChIKey | CVZALIOLCGXWJG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|