C25H41N3O4S — CID 18055527
tert-butyl N-[1-[[1-(2,5-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-ethylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18055527) has the molecular formula C25H41N3O4S and a molecular weight of 479.69 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2,5-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-ethylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2,5-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-ethylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18055527 |
| Molecular Formula | C25H41N3O4S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | tert-butyl N-[1-[[1-(2,5-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-ethylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1cc(C)ccc1C)N(CC)C(=O)C(CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H41N3O4S/c1-8-10-11-14-26-22(29)21(19-15-17(3)12-13-18(19)4)28(9-2)23(30)20(16-33)27-24(31)32-25(5,6)7/h12-13,15,20-21,33H,8-11,14,16H2,1-7H3,(H,26,29)(H,27,31) |
| InChIKey | NPZCLQIJUPPMOF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|