C29H47N3O6S — CID 18060667
methyl 2-[[2-(2,5-dimethylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-octylamino]acetyl]amino]acetate (PubChem CID 18060667) has the molecular formula C29H47N3O6S and a molecular weight of 565.78 g/mol. Its IUPAC name is methyl 2-[[2-(2,5-dimethylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-octylamino]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-(2,5-dimethylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-octylamino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 18060667 |
| Molecular Formula | C29H47N3O6S |
| Molecular Weight | 565.78 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | methyl 2-[[2-(2,5-dimethylphenyl)-2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]-octylamino]acetyl]amino]acetate |
| SMILES | CCCCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NCC(=O)OC)c1cc(C)ccc1C |
| InChI | InChI=1S/C29H47N3O6S/c1-8-9-10-11-12-13-16-32(27(35)23(19-39)31-28(36)38-29(4,5)6)25(26(34)30-18-24(33)37-7)22-17-20(2)14-15-21(22)3/h14-15,17,23,25,39H,8-13,16,18-19H2,1-7H3,(H,30,34)(H,31,36) |
| InChIKey | AEFRFXAWPDALAV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.78 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|