C28H45N3O6S — CID 18060382
methyl 2-[[2-(2,5-dimethylphenyl)-2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetyl]amino]acetate (PubChem CID 18060382) has the molecular formula C28H45N3O6S and a molecular weight of 551.75 g/mol. Its IUPAC name is methyl 2-[[2-(2,5-dimethylphenyl)-2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-(2,5-dimethylphenyl)-2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 18060382 |
| Molecular Formula | C28H45N3O6S |
| Molecular Weight | 551.75 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | methyl 2-[[2-(2,5-dimethylphenyl)-2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetyl]amino]acetate |
| SMILES | CCCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NCC(=O)OC)c1cc(C)ccc1C |
| InChI | InChI=1S/C28H45N3O6S/c1-8-9-10-11-12-15-31(26(34)22(18-38)30-27(35)37-28(4,5)6)24(25(33)29-17-23(32)36-7)21-16-19(2)13-14-20(21)3/h13-14,16,22,24,38H,8-12,15,17-18H2,1-7H3,(H,29,33)(H,30,35) |
| InChIKey | UIDYWVGCGJGKIG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.75 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|