C37H55N3O7S — CID 18060305
tert-butyl 2-[[2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]-3-phenylpropanoate (PubChem CID 18060305) has the molecular formula C37H55N3O7S and a molecular weight of 685.93 g/mol. Its IUPAC name is tert-butyl 2-[[2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[[2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 18060305 |
| Molecular Formula | C37H55N3O7S |
| Molecular Weight | 685.93 g/mol |
| Exact Mass | 685.38 |
| IUPAC Name | tert-butyl 2-[[2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]-2-(2-hydroxy-3-methylphenyl)acetyl]amino]-3-phenylpropanoate |
| SMILES | CCCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NC(Cc1ccccc1)C(=O)OC(C)(C)C)c1cccc(C)c1O |
| InChI | InChI=1S/C37H55N3O7S/c1-9-10-11-12-16-22-40(33(43)29(24-48)39-35(45)47-37(6,7)8)30(27-21-17-18-25(2)31(27)41)32(42)38-28(34(44)46-36(3,4)5)23-26-19-14-13-15-20-26/h13-15,17-21,28-30,41,48H,9-12,16,22-24H2,1-8H3,(H,38,42)(H,39,45) |
| InChIKey | XEPWFUVIYMCABJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.93 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|