C27H31ClN4O6 — CID 18061277
tert-butyl N-[5-amino-1-[[2-(2-chloro-6-methylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-ethynylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18061277) has the molecular formula C27H31ClN4O6 and a molecular weight of 543.02 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[2-(2-chloro-6-methylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-ethynylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[2-(2-chloro-6-methylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-ethynylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18061277 |
| Molecular Formula | C27H31ClN4O6 |
| Molecular Weight | 543.02 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[2-(2-chloro-6-methylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-ethynylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1Cl)c1ccccc1O |
| InChI | InChI=1S/C27H31ClN4O6/c1-6-32(25(36)19(14-15-21(29)34)30-26(37)38-27(3,4)5)23(17-11-7-8-13-20(17)33)24(35)31-22-16(2)10-9-12-18(22)28/h1,7-13,19,23,33H,14-15H2,2-5H3,(H2,29,34)(H,30,37)(H,31,35) |
| InChIKey | CJAOJZQLKHVSCY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.02 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|