C29H31ClN4O5 — CID 18061367
tert-butyl N-[5-amino-1-[[2-(2-chloro-6-methylanilino)-1-(4-ethynylphenyl)-2-oxoethyl]-ethynylamino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18061367) has the molecular formula C29H31ClN4O5 and a molecular weight of 551.04 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[2-(2-chloro-6-methylanilino)-1-(4-ethynylphenyl)-2-oxoethyl]-ethynylamino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[2-(2-chloro-6-methylanilino)-1-(4-ethynylphenyl)-2-oxoethyl]-ethynylamino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18061367 |
| Molecular Formula | C29H31ClN4O5 |
| Molecular Weight | 551.04 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[2-(2-chloro-6-methylanilino)-1-(4-ethynylphenyl)-2-oxoethyl]-ethynylamino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)Nc2c(C)cccc2Cl)N(C#C)C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H31ClN4O5/c1-7-19-12-14-20(15-13-19)25(26(36)33-24-18(3)10-9-11-21(24)30)34(8-2)27(37)22(16-17-23(31)35)32-28(38)39-29(4,5)6/h1-2,9-15,22,25H,16-17H2,3-6H3,(H2,31,35)(H,32,38)(H,33,36) |
| InChIKey | OXYBGLRKEBPLQS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.04 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|