C23H30N4O8 — CID 18061342
methyl 2-[[2-[[5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]-ethynylamino]-2-(3-hydroxyphenyl)acetyl]amino]acetate (PubChem CID 18061342) has the molecular formula C23H30N4O8 and a molecular weight of 490.51 g/mol. Its IUPAC name is methyl 2-[[2-[[5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]-ethynylamino]-2-(3-hydroxyphenyl)acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[[5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]-ethynylamino]-2-(3-hydroxyphenyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 18061342 |
| Molecular Formula | C23H30N4O8 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | methyl 2-[[2-[[5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]-ethynylamino]-2-(3-hydroxyphenyl)acetyl]amino]acetate |
| SMILES | C#CN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NCC(=O)OC)c1cccc(O)c1 |
| InChI | InChI=1S/C23H30N4O8/c1-6-27(21(32)16(10-11-17(24)29)26-22(33)35-23(2,3)4)19(14-8-7-9-15(28)12-14)20(31)25-13-18(30)34-5/h1,7-9,12,16,19,28H,10-11,13H2,2-5H3,(H2,24,29)(H,25,31)(H,26,33) |
| InChIKey | NHPUZXREIUQCHF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 177.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|