C25H36N4O6 — CID 18061332
tert-butyl N-[5-amino-1-[ethynyl-[1-(3-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18061332) has the molecular formula C25H36N4O6 and a molecular weight of 488.59 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[ethynyl-[1-(3-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[ethynyl-[1-(3-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18061332 |
| Molecular Formula | C25H36N4O6 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | tert-butyl N-[5-amino-1-[ethynyl-[1-(3-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1cccc(O)c1 |
| InChI | InChI=1S/C25H36N4O6/c1-6-8-9-15-27-22(32)21(17-11-10-12-18(30)16-17)29(7-2)23(33)19(13-14-20(26)31)28-24(34)35-25(3,4)5/h2,10-12,16,19,21,30H,6,8-9,13-15H2,1,3-5H3,(H2,26,31)(H,27,32)(H,28,34) |
| InChIKey | KUBRJEFCTJSOGL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|