C24H35N3O5 — CID 18032802
tert-butyl N-[1-[ethynyl-[1-(3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 18032802) has the molecular formula C24H35N3O5 and a molecular weight of 445.56 g/mol. Its IUPAC name is tert-butyl N-[1-[ethynyl-[1-(3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[ethynyl-[1-(3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18032802 |
| Molecular Formula | C24H35N3O5 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | tert-butyl N-[1-[ethynyl-[1-(3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1cccc(C)c1 |
| InChI | InChI=1S/C24H35N3O5/c1-7-9-10-14-25-21(29)20(18-13-11-12-17(3)15-18)27(8-2)22(30)19(16-28)26-23(31)32-24(4,5)6/h2,11-13,15,19-20,28H,7,9-10,14,16H2,1,3-6H3,(H,25,29)(H,26,31) |
| InChIKey | SUMNNVZUJXGKCZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|