C25H37N3O5 — CID 18032922
tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-ethynylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 18032922) has the molecular formula C25H37N3O5 and a molecular weight of 459.59 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-ethynylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-ethynylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18032922 |
| Molecular Formula | C25H37N3O5 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-ethynylamino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C25H37N3O5/c1-8-10-11-12-26-22(30)21(19-14-17(3)13-18(4)15-19)28(9-2)23(31)20(16-29)27-24(32)33-25(5,6)7/h2,13-15,20-21,29H,8,10-12,16H2,1,3-7H3,(H,26,30)(H,27,32) |
| InChIKey | LGOFZYRRFJNIFF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|