C26H37N5O5 — CID 18061675
tert-butyl N-[5-amino-1-[[2-(butylamino)-1-(3-ethenylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18061675) has the molecular formula C26H37N5O5 and a molecular weight of 499.61 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[[2-(butylamino)-1-(3-ethenylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[[2-(butylamino)-1-(3-ethenylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18061675 |
| Molecular Formula | C26H37N5O5 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | tert-butyl N-[5-amino-1-[[2-(butylamino)-1-(3-ethenylphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | C=Cc1cccc(C(C(=O)NCCCC)N(CC#N)C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H37N5O5/c1-6-8-15-29-23(33)22(19-11-9-10-18(7-2)17-19)31(16-14-27)24(34)20(12-13-21(28)32)30-25(35)36-26(3,4)5/h7,9-11,17,20,22H,2,6,8,12-13,15-16H2,1,3-5H3,(H2,28,32)(H,29,33)(H,30,35) |
| InChIKey | BJMSLHKWXJUCMO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 154.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|