C27H41N5O5 — CID 18061782
tert-butyl N-[5-amino-1-[cyanomethyl-[1-(2,6-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18061782) has the molecular formula C27H41N5O5 and a molecular weight of 515.66 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[cyanomethyl-[1-(2,6-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[cyanomethyl-[1-(2,6-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18061782 |
| Molecular Formula | C27H41N5O5 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | tert-butyl N-[5-amino-1-[cyanomethyl-[1-(2,6-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1c(C)cccc1C)N(CC#N)C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H41N5O5/c1-7-8-9-16-30-24(34)23(22-18(2)11-10-12-19(22)3)32(17-15-28)25(35)20(13-14-21(29)33)31-26(36)37-27(4,5)6/h10-12,20,23H,7-9,13-14,16-17H2,1-6H3,(H2,29,33)(H,30,34)(H,31,36) |
| InChIKey | HRMFEDPMXRLBFI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 154.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|