C33H39N3O6 — CID 18067548
tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-prop-2-enylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 18067548) has the molecular formula C33H39N3O6 and a molecular weight of 573.69 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-prop-2-enylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-prop-2-enylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18067548 |
| Molecular Formula | C33H39N3O6 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(2-hydroxyphenyl)-2-oxoethyl]-prop-2-enylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | C=CCN(C(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1C)c1ccccc1O |
| InChI | InChI=1S/C33H39N3O6/c1-7-19-36(31(40)26(34-32(41)42-33(4,5)6)20-23-15-17-24(37)18-16-23)29(25-13-8-9-14-27(25)38)30(39)35-28-21(2)11-10-12-22(28)3/h7-18,26,29,37-38H,1,19-20H2,2-6H3,(H,34,41)(H,35,39) |
| InChIKey | QBBOWYRJRKCZLD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|