C34H37N3O5 — CID 18067650
tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-prop-2-enylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 18067650) has the molecular formula C34H37N3O5 and a molecular weight of 567.69 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-prop-2-enylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-prop-2-enylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18067650 |
| Molecular Formula | C34H37N3O5 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-ethynylphenyl)-2-(2-methylanilino)-2-oxoethyl]-prop-2-enylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)Nc1ccccc1C)N(CC=C)C(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H37N3O5/c1-7-21-37(32(40)29(36-33(41)42-34(4,5)6)22-24-17-19-26(38)20-18-24)30(27-15-11-10-14-25(27)8-2)31(39)35-28-16-12-9-13-23(28)3/h2,7,9-20,29-30,38H,1,21-22H2,3-6H3,(H,35,39)(H,36,41) |
| InChIKey | DZPDKTOAAWGWFL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|