C13H15N5O2 — CID 18070557
N-(5-amino-2-methoxyphenyl)-2-[bis(cyanomethyl)amino]acetamide (PubChem CID 18070557) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is N-(5-amino-2-methoxyphenyl)-2-[bis(cyanomethyl)amino]acetamide.
| Compound Name | N-(5-amino-2-methoxyphenyl)-2-[bis(cyanomethyl)amino]acetamide |
|---|---|
| PubChem CID | 18070557 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-(5-amino-2-methoxyphenyl)-2-[bis(cyanomethyl)amino]acetamide |
| SMILES | COc1ccc(N)cc1NC(=O)CN(CC#N)CC#N |
| InChI | InChI=1S/C13H15N5O2/c1-20-12-3-2-10(16)8-11(12)17-13(19)9-18(6-4-14)7-5-15/h2-3,8H,6-7,9,16H2,1H3,(H,17,19) |
| InChIKey | HUQLARCOMFXSEK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|