C14H20N2O3 — CID 15475907
N-(5-amino-2-methoxyphenyl)-4,4-dimethyl-3-oxopentanamide (PubChem CID 15475907) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-(5-amino-2-methoxyphenyl)-4,4-dimethyl-3-oxopentanamide.
| Compound Name | N-(5-amino-2-methoxyphenyl)-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 15475907 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-(5-amino-2-methoxyphenyl)-4,4-dimethyl-3-oxopentanamide |
| SMILES | COc1ccc(N)cc1NC(=O)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H20N2O3/c1-14(2,3)12(17)8-13(18)16-10-7-9(15)5-6-11(10)19-4/h5-7H,8,15H2,1-4H3,(H,16,18) |
| InChIKey | QIBKNOFVALMFSR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|