C14H14N2O4 — CID 18074634
(2,6-dimethoxyphenyl) 5-methylpyrazine-2-carboxylate (PubChem CID 18074634) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl) 5-methylpyrazine-2-carboxylate.
| Compound Name | (2,6-dimethoxyphenyl) 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 18074634 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (2,6-dimethoxyphenyl) 5-methylpyrazine-2-carboxylate |
| SMILES | COc1cccc(OC)c1OC(=O)c1cnc(C)cn1 |
| InChI | InChI=1S/C14H14N2O4/c1-9-7-16-10(8-15-9)14(17)20-13-11(18-2)5-4-6-12(13)19-3/h4-8H,1-3H3 |
| InChIKey | MUKFRCUTKQEEND-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|