C16H12BrN3O5S — CID 18074722
3-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 18074722) has the molecular formula C16H12BrN3O5S and a molecular weight of 438.26 g/mol. Its IUPAC name is 3-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18074722 |
| Molecular Formula | C16H12BrN3O5S |
| Molecular Weight | 438.26 g/mol |
| Exact Mass | 436.97 |
| IUPAC Name | 3-[2-(5-bromothiophen-2-yl)-2-oxoethyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc([N+](=O)[O-])cc2)NC(=O)N(CC(=O)c2ccc(Br)s2)C1=O |
| InChI | InChI=1S/C16H12BrN3O5S/c1-16(9-2-4-10(5-3-9)20(24)25)14(22)19(15(23)18-16)8-11(21)12-6-7-13(17)26-12/h2-7H,8H2,1H3,(H,18,23) |
| InChIKey | JGYBDLJXKFBDPN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|