C20H15F4N3O7 — CID 41170247
(5S)-3-[2-[2,4-bis(difluoromethoxy)phenyl]-2-oxoethyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 41170247) has the molecular formula C20H15F4N3O7 and a molecular weight of 485.35 g/mol. Its IUPAC name is (5S)-3-[2-[2,4-bis(difluoromethoxy)phenyl]-2-oxoethyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-[2,4-bis(difluoromethoxy)phenyl]-2-oxoethyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41170247 |
| Molecular Formula | C20H15F4N3O7 |
| Molecular Weight | 485.35 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | (5S)-3-[2-[2,4-bis(difluoromethoxy)phenyl]-2-oxoethyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccc([N+](=O)[O-])cc2)NC(=O)N(CC(=O)c2ccc(OC(F)F)cc2OC(F)F)C1=O |
| InChI | InChI=1S/C20H15F4N3O7/c1-20(10-2-4-11(5-3-10)27(31)32)16(29)26(19(30)25-20)9-14(28)13-7-6-12(33-17(21)22)8-15(13)34-18(23)24/h2-8,17-18H,9H2,1H3,(H,25,30)/t20-/m0/s1 |
| InChIKey | BRNVICMBHMRLGL-FQEVSTJZSA-N |
| XLogP | 3.45 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|