C15H21N3O6S — CID 18078193
[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate (PubChem CID 18078193) has the molecular formula C15H21N3O6S and a molecular weight of 371.42 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 18078193 |
| Molecular Formula | C15H21N3O6S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COCCNC(=O)NC(=O)COC(=O)c1c(NC(C)=O)sc(C)c1C |
| InChI | InChI=1S/C15H21N3O6S/c1-8-9(2)25-13(17-10(3)19)12(8)14(21)24-7-11(20)18-15(22)16-5-6-23-4/h5-7H2,1-4H3,(H,17,19)(H2,16,18,20,22) |
| InChIKey | QGOQJQHAHSHFBA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|