C18H24ClN3O — CID 18078808
2-[(2-chlorophenyl)methyl-methylamino]-N-(1-cyanocyclohexyl)propanamide (PubChem CID 18078808) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-methylamino]-N-(1-cyanocyclohexyl)propanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(1-cyanocyclohexyl)propanamide |
|---|---|
| PubChem CID | 18078808 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(1-cyanocyclohexyl)propanamide |
| SMILES | CC(C(=O)NC1(C#N)CCCCC1)N(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C18H24ClN3O/c1-14(22(2)12-15-8-4-5-9-16(15)19)17(23)21-18(13-20)10-6-3-7-11-18/h4-5,8-9,14H,3,6-7,10-12H2,1-2H3,(H,21,23) |
| InChIKey | DJEKMNSQRRTFON-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |