C19H16N6O — CID 18079833
2,6-dimethyl-N-[4-(tetrazol-1-yl)phenyl]quinoline-4-carboxamide (PubChem CID 18079833) has the molecular formula C19H16N6O and a molecular weight of 344.38 g/mol. Its IUPAC name is 2,6-dimethyl-N-[4-(tetrazol-1-yl)phenyl]quinoline-4-carboxamide.
| Compound Name | 2,6-dimethyl-N-[4-(tetrazol-1-yl)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 18079833 |
| Molecular Formula | C19H16N6O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2,6-dimethyl-N-[4-(tetrazol-1-yl)phenyl]quinoline-4-carboxamide |
| SMILES | Cc1ccc2nc(C)cc(C(=O)Nc3ccc(-n4cnnn4)cc3)c2c1 |
| InChI | InChI=1S/C19H16N6O/c1-12-3-8-18-16(9-12)17(10-13(2)21-18)19(26)22-14-4-6-15(7-5-14)25-11-20-23-24-25/h3-11H,1-2H3,(H,22,26) |
| InChIKey | GOKZFPCRYYMMFY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |