C18H17N5O — CID 167933207
(E)-3-(2,4-dimethylphenyl)-N-[4-(tetrazol-1-yl)phenyl]prop-2-enamide (PubChem CID 167933207) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is (E)-3-(2,4-dimethylphenyl)-N-[4-(tetrazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethylphenyl)-N-[4-(tetrazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167933207 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (E)-3-(2,4-dimethylphenyl)-N-[4-(tetrazol-1-yl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2ccc(-n3cnnn3)cc2)c(C)c1 |
| InChI | InChI=1S/C18H17N5O/c1-13-3-4-15(14(2)11-13)5-10-18(24)20-16-6-8-17(9-7-16)23-12-19-21-22-23/h3-12H,1-2H3,(H,20,24)/b10-5+ |
| InChIKey | XDZYDPQYSVUNOT-BJMVGYQFSA-N |
| XLogP | 2.93 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|