C14H19N5O — CID 144816928
ethane;(E)-N-methyl-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enamide (PubChem CID 144816928) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is ethane;(E)-N-methyl-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | ethane;(E)-N-methyl-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 144816928 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | ethane;(E)-N-methyl-3-[5-methyl-2-(tetrazol-1-yl)phenyl]prop-2-enamide |
| SMILES | CC.CNC(=O)/C=C/c1cc(C)ccc1-n1cnnn1 |
| InChI | InChI=1S/C12H13N5O.C2H6/c1-9-3-5-11(17-8-14-15-16-17)10(7-9)4-6-12(18)13-2;1-2/h3-8H,1-2H3,(H,13,18);1-2H3/b6-4+; |
| InChIKey | LAWFQRMPUVRWGY-CVDVRWGVSA-N |
| XLogP | 1.76 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|