C21H26N2O4 — CID 18080601
[1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 6-oxo-1-propylpyridazine-3-carboxylate (PubChem CID 18080601) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 6-oxo-1-propylpyridazine-3-carboxylate.
| Compound Name | [1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 6-oxo-1-propylpyridazine-3-carboxylate |
|---|---|
| PubChem CID | 18080601 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [1-(4-tert-butylphenyl)-1-oxopropan-2-yl] 6-oxo-1-propylpyridazine-3-carboxylate |
| SMILES | CCCn1nc(C(=O)OC(C)C(=O)c2ccc(C(C)(C)C)cc2)ccc1=O |
| InChI | InChI=1S/C21H26N2O4/c1-6-13-23-18(24)12-11-17(22-23)20(26)27-14(2)19(25)15-7-9-16(10-8-15)21(3,4)5/h7-12,14H,6,13H2,1-5H3 |
| InChIKey | SVHNFDYRZXEBBP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |