C19H22ClFN2O2 — CID 18083569
2-[2-(4-chlorophenoxy)ethyl-methylamino]-N-[2-(4-fluorophenyl)ethyl]acetamide (PubChem CID 18083569) has the molecular formula C19H22ClFN2O2 and a molecular weight of 364.85 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)ethyl-methylamino]-N-[2-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[2-(4-chlorophenoxy)ethyl-methylamino]-N-[2-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 18083569 |
| Molecular Formula | C19H22ClFN2O2 |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)ethyl-methylamino]-N-[2-(4-fluorophenyl)ethyl]acetamide |
| SMILES | CN(CCOc1ccc(Cl)cc1)CC(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H22ClFN2O2/c1-23(12-13-25-18-8-4-16(20)5-9-18)14-19(24)22-11-10-15-2-6-17(21)7-3-15/h2-9H,10-14H2,1H3,(H,22,24) |
| InChIKey | NWRVEKFUFJAQSS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |