C18H16N2O3S2 — CID 18085277
2-(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 18085277) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 18085277 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | CC(NC(=O)CN1c2cccc3cccc(c23)S1(=O)=O)c1cccs1 |
| InChI | InChI=1S/C18H16N2O3S2/c1-12(15-8-4-10-24-15)19-17(21)11-20-14-7-2-5-13-6-3-9-16(18(13)14)25(20,22)23/h2-10,12H,11H2,1H3,(H,19,21) |
| InChIKey | PYNAEGJIWUMQLV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |