C16H19F3N2O4S — CID 18085368
[1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl] 2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 18085368) has the molecular formula C16H19F3N2O4S and a molecular weight of 392.40 g/mol. Its IUPAC name is [1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl] 2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | [1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl] 2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 18085368 |
| Molecular Formula | C16H19F3N2O4S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | [1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl] 2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC(=O)Nc1sc2c(c1C(=O)OC(C)C(=O)NCC(F)(F)F)CCCC2 |
| InChI | InChI=1S/C16H19F3N2O4S/c1-8(13(23)20-7-16(17,18)19)25-15(24)12-10-5-3-4-6-11(10)26-14(12)21-9(2)22/h8H,3-7H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | HBYDQNPYYNXPPZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |