C22H22N2O3 — CID 18086673
N-[1-(1-benzofuran-2-yl)ethyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 18086673) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 18086673 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(CN2CCCC2=O)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C22H22N2O3/c1-15(20-13-18-5-2-3-6-19(18)27-20)23-22(26)17-10-8-16(9-11-17)14-24-12-4-7-21(24)25/h2-3,5-6,8-11,13,15H,4,7,12,14H2,1H3,(H,23,26) |
| InChIKey | PXLOICHELPKQJT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |