C23H24N2O3 — CID 51933016
N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-N-methyl-3-[(2-oxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 51933016) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-N-methyl-3-[(2-oxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-N-methyl-3-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 51933016 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-N-methyl-3-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | C[C@@H](c1cc2ccccc2o1)N(C)C(=O)c1cccc(CN2CCCC2=O)c1 |
| InChI | InChI=1S/C23H24N2O3/c1-16(21-14-18-8-3-4-10-20(18)28-21)24(2)23(27)19-9-5-7-17(13-19)15-25-12-6-11-22(25)26/h3-5,7-10,13-14,16H,6,11-12,15H2,1-2H3/t16-/m0/s1 |
| InChIKey | OWYWPAFCYUCSFW-INIZCTEOSA-N |
| XLogP | 4.39 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |